1314-56-3 Phosphorus pentoxide
| product Name |
Phosphorus pentoxide |
| CAS No |
1314-56-3 |
| Synonyms |
Phosphoric anhydride; Phosphorus(V) oxide; phosphorus pentoxidedessicant; Phosphorous Pentoxide; Phosphorus pentoxide 99+ % for analysis; diphosphorus pentaoxide; PhosphorusVoxideACSwhitepowder; Phosphorusoxidewhitepowder; Phosphoric Pentoxide; P2O5; tricyclo[3.3.1.1~3,7~]tetraphosphoxane 1,3,5,7-tetraoxide; 1,3-dioxodiphosphoxane-1,3-diium-1,3-diolate; Phosphorus(Ⅴ)oxide; Phosphorous Pentoxide (P2O5) |
| Molecular Formula |
P2O5 |
| Molecular Weight |
141.9445 |
| InChI |
InChI=1/O5P2/c1-6(2)5-7(3)4 |
| EINECS |
215-236-1 |
| Molecular Structure |
|
| Melting point |
340-360℃ |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R35:;
|
| Safety Description |
S22:;
S26:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|