141-32-2 Butyl Acrylate
| product Name |
Butyl Acrylate |
| CAS No |
141-32-2 |
| Synonyms |
2-Propenoic acid butyl ester; Butyl 2-Propenoate; n-Butyl Acrylate; Propenoic acid n-butyl ester; butyl prop-2-enoate; 2-methylidenehexanoate; BA; Butylacrylate,inhibited; acrylatedebutyle; 1-butylacrylate |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.1616 |
| InChI |
InChI=1/C7H12O2/c1-3-4-5-6(2)7(8)9/h2-5H2,1H3,(H,8,9)/p-1 |
| EINECS |
205-480-7 |
| Molecular Structure |
|
| Melting point |
-64℃ |
| Boiling point |
221.938°C at 760 mmHg |
| Flash point |
128.629°C |
| Water solubility |
1.4 g/L (20℃) |
| Vapour Pressur |
0.039mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:;
R36/37/38:;
R43:;
|
| Safety Description |
S9:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Description |
| Physicochemical properties | Color Odor State: Colorless liquid | Toxicity: low toxicity | | Flammability: easy to burn | Density: 0.89 | | Volatile: easily volatile | Corrosivity: no corrosion | | Boiling point: 145.7¡æ | Decomposability: high temperature decomposition | | Stability: stable | Melting point: -64.6¡ãC | | Auto-ignition point: 275¡æ | Flash point: 37 ¡æ | | Solubility: insoluble in water, miscible in ethanol and ether. | | Uses | Mainly used in the produ... |
| Telephone |
+86-546-6878189 |
| Email |
export2@chemlongxing.com |
| Address |
Dawang Economy Technology Development Zone,Guangrao County,Dongying City,Shandong Province,China. |
| Contact |
Lian Zhi jie |
| Telephone |
+86-21-51920719-8001 |
| Email |
zhijielian@heshensh.com |
| Address |
Room 1501 the Blue Sea Modern Court 2 Floor No 277 Zheqiao Road,Shanghai,China |
| Telephone |
+86-10-69328630 |
| Email |
sales@yzwychem.com |
| Address |
Zhuge Village( at the behind of Chengguan ST.),Fangshan Borough, Beijing City, P.R.C. |
| Telephone |
+86-22-25292466 |
| Email |
info@sinochemhb.com |
| Address |
6-F,Tianjin International Development Building No.2,Dongting Road TEDA Tianjin China |
| Telephone |
+86-760-3131966 3131616 3131911 3131633 |
| Email |
sx@shunxiang.com.cn |
| Address |
Minan Industrial Zone, Nantou Town, Zhongshan, Guangdong province |
|