ChemNet > CAS > 156333-95-8 4-(2-IODOBENZYL)MORPHOLINE
156333-95-8 4-(2-IODOBENZYL)MORPHOLINE
| product Name |
4-(2-IODOBENZYL)MORPHOLINE |
| CAS No |
156333-95-8 |
| Molecular Formula |
C11H14INO |
| Molecular Weight |
303.1394 |
| InChI |
InChI=1/C11H14INO/c12-11-4-2-1-3-10(11)9-13-5-7-14-8-6-13/h1-4H,5-9H2 |
| Molecular Structure |
|
| Density |
1.604g/cm3 |
| Melting point |
46℃ |
| Boiling point |
331.34°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
154.189°C |
| Vapour Pressur |
0mmHg at 25°C |
|