2883-98-9 alpha-Asarone
| product Name |
alpha-Asarone |
| CAS No |
2883-98-9 |
| Molecular Formula |
C12H16O3 |
| Molecular Weight |
208.2536 |
| InChI |
InChI=1/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5+ |
| EINECS |
220-743-6 |
| Molecular Structure |
|
| Density |
1.028g/cm3 |
| Melting point |
57-61℃ |
| Boiling point |
296°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
107.7°C |
| Vapour Pressur |
0.0026mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S22:;
S24/25:;
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58£¬61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr. Kang |
| Telephone |
+86-371-64899527 013837178289 |
| Email |
export@ktpharm.com |
| Address |
No. 338, Kangtai Road, Sishui Town, Xingyang City, Henan Province, China |
| Specifications |
99% min |
| Packing |
25kg 50kg drum or bag |
| Description |
What is the chemical of alpha-Asarone ? Appearance: White to off-white crystalline powder£» Assay:99%min by HPLC£» IR Identity: conform to standard£» HNMR£º conform to standard£» carbon spectrum: conform to standard£» Water by K. F.:0.5% max or as per the customer¡¯s request£» Loss on drying:0.5% max. or as per the customer¡¯s request£» =============================================================================== Uses: It is used for Chinese medicine reference standards, pharmacological experiments, and flavoring industries, and has potential pharmacological activities such as anti-inflammatory, sedative, and anti-tumor effects. ¦Á-Asarone exhibits various pharmacological activities, mainly including: Respiratory system: Cough suppression, expectoration, and bronchodilation, used in the treatment of chronic bronchitis, asthma, etc. Nervous system: Sedation, spasmolysis, and anti-epileptic effects. Cardiovascular system: Lipid-lowering and lipid-regulating properties. Antibacteria... |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |