ChemNet > CAS > 29668-44-8 1,4-Benzodioxan-6-carboxaldehyde
29668-44-8 1,4-Benzodioxan-6-carboxaldehyde
| product Name |
1,4-Benzodioxan-6-carboxaldehyde |
| Synonyms |
2,3-Dihydro-1,4-benzodioxine-6-carbaldehyde; 2,3-dihydrobenzo[b][1,4]dioxine-6-carbaldehyde; 4H-1,3-benzodioxine-6-carbaldehyde; 1,4-Benzodioxane-6-carboxaldehyde; 1,4-Benzodioxin-6-carboxaldehyde |
| Molecular Formula |
C9H8O3 |
| Molecular Weight |
164.158 |
| InChI |
InChI=1/C9H8O3/c10-4-7-1-2-9-8(3-7)5-11-6-12-9/h1-4H,5-6H2 |
| CAS Registry Number |
29668-44-8 |
| EINECS |
249-763-3 |
| Molecular Structure |
|
| Density |
1.262g/cm3 |
| Melting point |
50-52℃ |
| Boiling point |
324.9°C at 760 mmHg |
| Refractive index |
1.588 |
| Flash point |
141.4°C |
| Vapour Pressur |
0.000238mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
