ChemNet > CAS > 303-26-4 1-(4-Chlorobenzhydryl)piperazine
303-26-4 1-(4-Chlorobenzhydryl)piperazine
| product Name |
1-(4-Chlorobenzhydryl)piperazine |
| CAS No |
303-26-4 |
| Synonyms |
1-(4-Chlorophenylmethyl)piperazine; 1-[(4-Chlorophenyl) phenylmethyl] piperazine; 1-[4-chlorophenyl) (phenyl)methyl] piperazine; 1-[(R)-(4-chlorophenyl)(phenyl)methyl]piperazinediium; 1-[(S)-(4-chlorophenyl)(phenyl)methyl]piperazinediium; Chlorophenyl)(phenyl)methyl)piperazine,1-((4-; N-(p-Chlorobenzhydryl)-piperazine; N-(4-Chlorophenyl)phenylmethylpiperazine; 1-(4-Chlorobenzhydryl)-piperizine |
| Molecular Formula |
C17H21ClN2 |
| Molecular Weight |
288.8139 |
| InChI |
InChI=1/C17H19ClN2/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20/h1-9,17,19H,10-13H2/p+2/t17-/m0/s1 |
| EINECS |
206-137-4 |
| Molecular Structure |
|
| Melting point |
65-75℃ |
| Boiling point |
409.1°C at 760 mmHg |
| Flash point |
193.3°C |
| Vapour Pressur |
6.66E-07mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|