ChemNet > CAS > 305-53-3 Iodoacetic acid, sodium salt
305-53-3 Iodoacetic acid, sodium salt
| product Name |
Iodoacetic acid, sodium salt |
| CAS No |
305-53-3 |
| Synonyms |
Sodium iodoacetate; Iodoacetic acid sodium salt |
| Molecular Formula |
C2H2INaO2 |
| Molecular Weight |
207.9303 |
| InChI |
InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| EINECS |
206-165-7 |
| Molecular Structure |
|
| Melting point |
208-210℃ |
| Boiling point |
262.1°C at 760 mmHg |
| Flash point |
112.3°C |
| Vapour Pressur |
0.00329mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-576-7379999 |
| Email |
kkk@cnhichi.com |
| Address |
Binghe Road, Damaiyu Economic Development Zone, Yuhuan, Zhejiang |