ChemNet > CAS > 3751-48-2 3-(3-Methylphenyl)propionic acid
3751-48-2 3-(3-Methylphenyl)propionic acid
| product Name |
3-(3-Methylphenyl)propionic acid |
| CAS No |
3751-48-2 |
| Synonyms |
3-(3-methylphenyl)propanoic acid |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8-3-2-4-9(7-8)5-6-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12) |
| Molecular Structure |
|
| Density |
1.097g/cm3 |
| Boiling point |
289.9°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
187.1°C |
| Vapour Pressur |
0.000986mmHg at 25°C |
|