CAS No: 3779-03-1, Chemical Name: 2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one
the physical and chemical property of 3779-03-1, 2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one is provided by ChemNet.com
ChemNet > CAS > 3779-03-1 2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one
3779-03-1 2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one
| product Name |
2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one |
| Synonyms |
2,3-Dihydroxanthotoxin; NSC 401281; 2,3-Dihydro-9-methoxy-7H-furo(3,2-g)(1)benzopyran-7-one; 7H-Furo(3,2-g)(1)benzopyran-7-one, 2,3-dihydro-9-methoxy-; 9-methoxy-2,3-dihydro-7H-furo[3,2-g]chromen-7-one |
| Molecular Formula |
C12H10O4 |
| Molecular Weight |
218.2054 |
| InChI |
InChI=1/C12H10O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-3,6H,4-5H2,1H3 |
| CAS Registry Number |
3779-03-1 |
| EINECS |
223-238-9 |
| Molecular Structure |
![3779-03-1 2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one](http://images-a.chemnet.com/suppliers/chembase/cas3/cas3779-03-1.gif)
|
| Density |
1.353g/cm3 |
| Boiling point |
421°C at 760 mmHg |
| Refractive index |
1.606 |
| Flash point |
192.2°C |
| Vapour Pressur |
2.69E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
