41814-78-2 Tricyclazole
| product Name |
Tricyclazole |
| CAS No |
41814-78-2 |
| Synonyms |
Tricycloazole; Beam; Bim; Blascide; 5-methyl-1,2,4-triazolo[3,4-b][1,3]benzothiazole; Methyl-1,2,4-triazolo[3,4-b]benzo-1,3-thiazole; Methyl-1,2,4-triazolo(3,4-b)benzothiazole |
| Molecular Formula |
C9H7N3S |
| Molecular Weight |
189.237 |
| InChI |
InChI=1/C9H7N3S/c1-6-3-2-4-7-8(6)12-5-10-11-9(12)13-7/h2-5H,1H3 |
| EINECS |
255-559-5 |
| Molecular Structure |
|
| Density |
1.5g/cm3 |
| Melting point |
187-188℃ |
| Refractive index |
1.806 |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
|
Featured China Suppliers
| Description |
It is mainly used for the prevention and control of rice blast |
| Contact |
Bu Yajing |
| Telephone |
+86-510-87508213 |
| Email |
miranda@liaoyuanchem.com |
| Address |
Zhoutie Town,Yixing, Jiangsu Province, China |
| Telephone |
+86-25-84729803;84703409 |
| Email |
info@trustchem.com |
| Address |
D/23rd Floor Golden Eagle International Plaza, 89 Hanzhong Rd., Nanjing, 210029, China |
| Contact |
York Jiang |
| Telephone |
86-21-65520181 |
| Email |
szfr168@81890.net, york@goldenharvest-chem.com |
| Address |
Rm.10C,Top Boss Bldg.,159 Handan Rd.,Shanghai .China |
| Telephone |
86-21-58206762 58208698 |
| Email |
dfm@sacicinfo.com |
| Address |
11F/E No. 818 Dongfang Rd. Pu Dong New Area Shanghai 200122 China |
| Telephone |
86-571-81956191 81956192 |
| Email |
Info@sinocochem.com |
| Address |
425 Ruiqi Mansion Moganshan Road , Hangzhou 310011 China. |