ChemNet > CAS > 480-63-7 2,4,6-Trimethylbenzoic acid
480-63-7 2,4,6-Trimethylbenzoic acid
| product Name |
2,4,6-Trimethylbenzoic acid |
| CAS No |
480-63-7 |
| Synonyms |
Mesitylenecarboxylic acid; Mesitoic acid; Mesitylene-2-carboxylic acid; 2,4,6-Trimethyl Benzoic Acid; 2,4,6-trimethylbenzoate |
| Molecular Formula |
C10H11O2 |
| Molecular Weight |
163.1937 |
| InChI |
InChI=1/C10H12O2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3,(H,11,12)/p-1 |
| EINECS |
207-553-9 |
| Molecular Structure |
|
| Melting point |
153-155℃ |
| Boiling point |
296.6°C at 760 mmHg |
| Flash point |
138°C |
| Vapour Pressur |
0.000639mmHg at 25°C |
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|