ChemNet > CAS > 5433-01-2 1-Bromo-3-isopropylbenzene
5433-01-2 1-Bromo-3-isopropylbenzene
| product Name |
1-Bromo-3-isopropylbenzene |
| Synonyms |
3-Bromocumene; 3-Isopropylbromobenzene; 1-bromo-3-(propan-2-yl)benzene |
| Molecular Formula |
C9H11Br |
| Molecular Weight |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-7(2)8-4-3-5-9(10)6-8/h3-7H,1-2H3 |
| CAS Registry Number |
5433-01-2 |
| Molecular Structure |
|
| Density |
1.278g/cm3 |
| Boiling point |
210.6°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
81.8°C |
| Vapour Pressur |
0.277mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
