5445-29-4 Ethyl 2-bromooctanoate
| product Name |
Ethyl 2-bromooctanoate |
| CAS No |
5445-29-4 |
| Synonyms |
Ethyl 2-bromocaprylate; 2-Bromooctanoic acid ethyl ester; Octanoic acid, 2-bromoethyl ester; α-Bromo-octanoic acid ethyl ester; Ethyl 2-bromooctanoate, 98+%; Ethyl 2-caprylate; ALPHA-BROMO-OCTANOIC ACID ETHYL ESTER; ethyl (2S)-2-bromooctanoate; ethyl (2R)-2-bromooctanoate |
| Molecular Formula |
C10H19BrO2 |
| Molecular Weight |
251.1607 |
| InChI |
InChI=1/C10H19BrO2/c1-3-5-6-7-8-9(11)10(12)13-4-2/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| EINECS |
226-647-0 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Boiling point |
243.1°C at 760 mmHg |
| Refractive index |
1.461 |
| Flash point |
112.1°C |
| Vapour Pressur |
0.0327mmHg at 25°C |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Vivien |
| Telephone |
+86-515-83073966;83072966 |
| Email |
sales02@jssdchem.com,yc@jssdchem.com |
| Address |
Aoyang Chemical Park, Funing County, Yancheng, China |
| Contact |
Jane Zhang |
| Telephone |
+86-515-88706880 |
| Email |
sales@longshenchem.com |
| Address |
No.13 Weiyi Road, Aoyang Industrial Park, Funing County, Yancheng, Jiangsu, China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |