ChemNet > CAS > 5471-51-2 4-(4-hydroxyphenyl)-2-butanone
5471-51-2 4-(4-hydroxyphenyl)-2-butanone
| product Name |
4-(4-hydroxyphenyl)-2-butanone |
| CAS No |
5471-51-2 |
| Synonyms |
Raspberry ketone natural; 2-(4-Hydroxyphenyl)ethyl methyl ketone; 4-Hydroxybenzylacetone; Raspberry ketone synthetic; Raspberry Ketone; 4-(4-hydroxyphenyl)butan-2-one; 4-(p-hydroxyphenyl)-2-butanone; 4-(4-Hydoxylphenyl)-2-butanone |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-7,12H,2-3H2,1H3 |
| EINECS |
226-806-4 |
| Molecular Structure |
|
| Density |
1.088g/cm3 |
| Melting point |
82-84℃ |
| Boiling point |
292.2°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
122.9°C |
| Water solubility |
Insoluble in water; Soluble in ethanol and diethyl ether |
| Vapour Pressur |
0.00106mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| MSDS |
Material Safety Data Sheet
|
|