5753-96-8 Ethyl 2-oxohexanoate
| product Name |
Ethyl 2-oxohexanoate |
| CAS No |
5753-96-8 |
| Synonyms |
2-oxohexanoic acid ethyl ester; ethyl alpha-ketocaproate |
| Molecular Formula |
C8H14O3 |
| Molecular Weight |
158.195 |
| InChI |
InChI=1/C8H14O3/c1-3-5-6-7(9)8(10)11-4-2/h3-6H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.981g/cm3 |
| Boiling point |
211.725°C at 760 mmHg |
| Refractive index |
1.421 |
| Flash point |
81.288°C |
| Vapour Pressur |
0.18mmHg at 25°C |
|