5786-21-0 clozapine
| product Name |
clozapine |
| CAS No |
5786-21-0 |
| Synonyms |
5H-Dibenzo(b,e)(1,4)diazepine, 8-chloro-11-(4-methyl-1-piperazinyl)-; 8-Chloro-11-(4-methyl-1-piperazinyl)-5H-dibenzo(b,e)(1,4)diazepine; BRN 0764984; CCRIS 9171; Clorazil; Clozapin; Clozapina; Clozapina [INN-Spanish]; Clozapinum; Clozapinum [INN-Latin]; Clozaril; Fazaclo; Fazaclo ODT; HF-1854; HSDB 6478; Iprox; LX 100-129; Leponex; UNII-J60AR2IKIC; W-801; 8-chloro-11-(4-methylpiperazin-1-yl)-5H-dibenzo[b,e][1,4]diazepine |
| Molecular Formula |
C18H19ClN4 |
| Molecular Weight |
326.8233 |
| InChI |
InChI=1/C18H19ClN4/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-15(14)20-16-7-6-13(19)12-17(16)21-18/h2-7,12,20H,8-11H2,1H3 |
| EINECS |
227-313-7 |
| Molecular Structure |
|
| Density |
1.319g/cm3 |
| Melting point |
182-185℃ |
| Boiling point |
489.159°C at 760 mmHg |
| Refractive index |
1.681 |
| Flash point |
249.635°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R22:;
R36/37/38:;
|
| Safety Description |
S26:;
|
|
Featured China Suppliers
| Telephone |
+86-576-88516108;88582618 |
| Email |
sales@xm-chem.com |
| Address |
89#, Binhai Road, Jiaojiang, Taizhou City, Zhejiang Province, China. |
| Contact |
York Jiang |
| Telephone |
86-21-65520181 |
| Email |
szfr168@81890.net, york@goldenharvest-chem.com |
| Address |
Rm.10C,Top Boss Bldg.,159 Handan Rd.,Shanghai .China |
| Telephone |
+86-25-83247442/443/445/446/447 |
| Email |
sales@levachem.com |
| Address |
2112 SuNing Universal Mansion, 188 Guangzhou Road, Nanjing 210024, China |
| Description |
| CAS (CAS No) | 5786-21-0 | (Cate) | (Pharmaceutical Material) | | (Product name) | (8-chloro-11(4-methy-1-piperaziong)-5-H-dibenzo[b,e][1.4]diazepine) | (Structural Formula) | | | ( Molecular) | C18H19ClN4 | <...
| Telephone |
+86-536-5102364,5103738 |
| Email |
export@shouguangpharm.com |
| Address |
North-East of Dongwaihuan Road, Dongcheng Industrial Area£¬Shouguang City£¬Shandong Province£¬P.R. of China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |
|