CAS No: 61770-41-0, Chemical Name: 4a,5,10,10a-tetrahydro-4H-5,10-methanobenzo[g]thiochromene 1,1-dioxide
the physical and chemical property of 61770-41-0, 4a,5,10,10a-tetrahydro-4H-5,10-methanobenzo[g]thiochromene 1,1-dioxide is provided by ChemNet.com
ChemNet > CAS > 61770-41-0 4a,5,10,10a-tetrahydro-4H-5,10-methanobenzo[g]thiochromene 1,1-dioxide
61770-41-0 4a,5,10,10a-tetrahydro-4H-5,10-methanobenzo[g]thiochromene 1,1-dioxide
| product Name |
4a,5,10,10a-tetrahydro-4H-5,10-methanobenzo[g]thiochromene 1,1-dioxide |
| Synonyms |
|
| Molecular Formula |
C14H14O2S |
| Molecular Weight |
246.3248 |
| InChI |
InChI=1/C14H14O2S/c15-17(16)7-3-6-11-12-8-13(14(11)17)10-5-2-1-4-9(10)12/h1-5,7,11-14H,6,8H2 |
| CAS Registry Number |
61770-41-0 |
| Molecular Structure |
![61770-41-0 4a,5,10,10a-tetrahydro-4H-5,10-methanobenzo[g]thiochromene 1,1-dioxide](https://images-a.chemnet.com/suppliers/chembase/cas78/61770-41-0.png)
|
| Density |
1.318g/cm3 |
| Boiling point |
466.5°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
306.3°C |
| Vapour Pressur |
1.97E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
