6326-79-0 6-bromoisatin
| product Name |
6-bromoisatin |
| CAS No |
6326-79-0 |
| Synonyms |
6-Bromoindole-2,3-dione; 6-bromo-1H-indole-2,3-dione; Indole-2,3-dione,6-bromo- (8CI); 6-Bromoisatin; NSC 30748; 1H-Indole-2,3-dione,6-bromo-; 6-Bromo-2,3-Indolinedione |
| Molecular Formula |
C8H4BrNO2 |
| Molecular Weight |
226.0269 |
| InChI |
InChI=1/C8H4BrNO2/c9-4-1-2-5-6(3-4)10-8(12)7(5)11/h1-3H,(H,10,11,12) |
| Molecular Structure |
|
| Density |
1.826g/cm3 |
| Refractive index |
1.649 |
|