| product Name |
Kasugamycin |
| CAS No |
6980-18-3 |
| Synonyms |
(1S,2R,3S,4R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl 2-amino-4-{[carboxy(imino)methyl]amino}-2,3,4,6-tetradeoxy-alpha-D-lyxo-hexopyranoside |
| Molecular Formula |
C14H25N3O9 |
| Molecular Weight |
379.363 |
| InChI |
InChI=1/C14H25N3O9/c1-3-5(17-12(16)13(23)24)2-4(15)14(25-3)26-11-9(21)7(19)6(18)8(20)10(11)22/h3-11,14,18-22H,2,15H2,1H3,(H2,16,17)(H,23,24)/t3-,4+,5-,6-,7+,8+,9-,10+,11+,14-/m1/s1 |
| Molecular Structure |
|
| Density |
1.973g/cm3 |
| Boiling point |
585.944°C at 760 mmHg |
| Refractive index |
1.738 |
| Flash point |
308.168°C |
| Vapour Pressur |
0mmHg at 25°C |
|