ChemNet > CAS > 7116-48-5 ethyl 1,3-benzodioxole-5-propionate
7116-48-5 ethyl 1,3-benzodioxole-5-propionate
| product Name |
ethyl 1,3-benzodioxole-5-propionate |
| CAS No |
7116-48-5 |
| Synonyms |
Ethyl 1,3-benzodioxole-5-propionate; AI3-30061; 1,3-Benzodioxole-5-propanoic acid, ethyl ester; ethyl 3-(1,3-benzodioxol-5-yl)propanoate |
| Molecular Formula |
C12H14O4 |
| Molecular Weight |
222.2372 |
| InChI |
InChI=1/C12H14O4/c1-2-14-12(13)6-4-9-3-5-10-11(7-9)16-8-15-10/h3,5,7H,2,4,6,8H2,1H3 |
| EINECS |
230-418-0 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Boiling point |
311.5°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
135.3°C |
| Vapour Pressur |
0.00056mmHg at 25°C |
|