ChemNet > CAS > 79723-02-7 tetramethylammonium hydrogen phthalate
79723-02-7 tetramethylammonium hydrogen phthalate
| product Name |
tetramethylammonium hydrogen phthalate |
| CAS No |
79723-02-7 |
| Synonyms |
Tetramethylammonium phthalate monobasic; N,N,N-trimethylmethanaminium 2-carboxybenzoate |
| Molecular Formula |
C12H17NO4 |
| Molecular Weight |
239.2677 |
| InChI |
InChI=1/C8H6O4.C4H12N/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-5(2,3)4/h1-4H,(H,9,10)(H,11,12);1-4H3/q;+1/p-1 |
| EINECS |
416-900-5 |
| Molecular Structure |
|
| Melting point |
142-146℃ |
|