ChemNet > CAS > 827-95-2 3-nitrobenzoic acid sodium salt
827-95-2 3-nitrobenzoic acid sodium salt
| product Name |
3-nitrobenzoic acid sodium salt |
| CAS No |
827-95-2 |
| Synonyms |
Sodium 3-nitrobenzoate; Sodium m-nitrobenzoate; 1-(octanoyloxy)pyrrolidine-2,5-dione; m-Nitrobenzoic acid,sodium salt; m-Nitrobenzoic acid sodium |
| Molecular Formula |
C12H19NO4 |
| Molecular Weight |
241.2836 |
| InChI |
InChI=1/C12H19NO4/c1-2-3-4-5-6-7-12(16)17-13-10(14)8-9-11(13)15/h2-9H2,1H3 |
| EINECS |
212-578-3 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Boiling point |
333.2°C at 760 mmHg |
| Refractive index |
1.492 |
| Flash point |
155.3°C |
| Vapour Pressur |
0.000139mmHg at 25°C |
| Risk Codes |
R22:;
|
| Safety Description |
S22:;
S36/37:;
|
|