| product Name |
1,3,5-Tris(2-hydroxyethyl)cyanuric acid |
| CAS No |
839-90-7 |
| Synonyms |
tris(2-hydroxyethyl)-1,3,5-triazinetrione; tris(2-hydroxyethyl) isocyanurate; tris(2-hydroxyethyl) isoyanurate; THEIC; 1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione; 1,3,5-tris(2-hydroxyethyl)-2-oxo-1,2$l4,3-triazacyclohexane-4,6-dione; Tris(2-hydroxyethyl)Isocyanurate |
| Molecular Formula |
C9H16N3O6 |
| Molecular Weight |
262.23984 |
| InChI |
InChI=1/C9H16N3O6/c13-4-1-7-8(16)10(2-5-14)12(18)11(3-6-15)9(7)17/h7,13-15H,1-6H2 |
| EINECS |
212-660-9 |
| Molecular Structure |
|
| Melting point |
136-140℃ |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|