89796-99-6 Aceclofenac
| product Name |
Aceclofenac |
| CAS No |
89796-99-6 |
| Synonyms |
2-(2-(2-(2,6-dichlorophenyl)aminophenyl)acetyl)oxyacetic acid; 2-((2,6-dichlorophenyl)amino)-benzeneacetic aci carboxymethyl ester; [({2-[(2,6-dichlorophenyl)amino]phenyl}acetyl)oxy]acetic acid |
| Molecular Formula |
C16H13Cl2NO4 |
| Molecular Weight |
354.1847 |
| InChI |
InChI=1/C16H13Cl2NO4/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21/h1-7,19H,8-9H2,(H,20,21) |
| Molecular Structure |
|
| Density |
1.455g/cm3 |
| Melting point |
149-153℃ |
| Boiling point |
486°C at 760 mmHg |
| Refractive index |
1.639 |
| Flash point |
247.7°C |
| Vapour Pressur |
2.93E-10mmHg at 25°C |
|