96-34-4 methyl chloroacetate
| product Name |
methyl chloroacetate |
| CAS No |
96-34-4 |
| Synonyms |
chloroacetic acid methyl ester; Methyl ester chloroacetic acid |
| Molecular Formula |
C3H5ClO2 |
| Molecular Weight |
108.5236 |
| InChI |
InChI=1/C3H5ClO2/c1-6-3(5)2-4/h2H2,1H3 |
| EINECS |
202-501-1 |
| Molecular Structure |
|
| Density |
1.167g/cm3 |
| Melting point |
-33℃ |
| Boiling point |
132.2°C at 760 mmHg |
| Refractive index |
1.4 |
| Flash point |
51.7°C |
| Water solubility |
28 g/L (20℃) |
| Vapour Pressur |
8.97mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R10:;
R23/25:;
R37/38:;
R41:;
|
| Safety Description |
S26:;
S37/39:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr.Yang |
| Telephone |
+86-510-83551979 |
| Email |
sales@wxyschem.com |
| Address |
Yangshi, Luoshe, Huishan District, Wuxi, 214154 Jiangsu, China |
| Contact |
Manger Tong(Dioxane);Manger Jin(Dioxolane);Manger Zhu(intermediates) |
| Telephone |
+86-13815978817;13805265617 |
| Email |
zhou@senxuan.cn |
| Address |
Hongqiao Industrial Zone, Taixing, Jiangsu, China. |
| Telephone |
86-571-87630650 |
| Email |
sales@depewchem.com |
| Address |
6-6F£¬Matrix Int'l Ctr, No.515 Yuhangtang Road, Hangzhou, 310011, China |
| Description |
| Physicochemical properties | Color and odor state: colorless transparent liquid with pungent odor | Toxicity: High toxicity | | Flammability: Flammable | Density: Relative density (water=1): 1.24 | | Volatility: Volatile | Corrosive: corrosive | | Boiling point: 129.8°C | Degradability: Not easy to decompose | | Stability: Stability | Melting point: -32.1°C | | Acidity-alkaline: neutral | Moisture absorption: slightly moisture absorption | | Spontaneous ignition point: 465°C | Viscosity: Low viscosity | | Deliquescence: No deliquescence | Flash point: 51°C (closed). |
| Telephone |
+86-546-6878189 |
| Email |
export2@chemlongxing.com |
| Address |
Dawang Economy Technology Development Zone,Guangrao County,Dongying City,Shandong Province,China. |
| Contact |
Liu Fucheng |
| Telephone |
+86-728-4719318 13807222398 |
| Email |
xcyy@chengyupharm.com |
| Address |
No.1 Yuefei Av., Yuekou town, Tianmen city, Hubei province, China |
|