ChemNet > CAS > 175204-45-2 4-(Bromomethyl)-2,6-dichloropyridine
175204-45-2 4-(Bromomethyl)-2,6-dichloropyridine
| Ονομασία του προϊόντος |
4-(Bromomethyl)-2,6-dichloropyridine |
| Αγγλικό όνομα |
4-(Bromomethyl)-2,6-dichloropyridine; |
| MF |
C6H4BrCl2N |
| Μοριακό βάρος |
240.9127 |
| InChI |
InChI=1/C6H4BrCl2N/c7-3-4-1-5(8)10-6(9)2-4/h1-2H,3H2 |
| CAS ΟΧΙ |
175204-45-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.77g/cm3 |
| Σημείο βρασμού |
299.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.603 |
| Σημείο ανάφλεξης |
134.8°C |
| Πίεση ατμών |
0.00215mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
C:Corrosive;
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|