ChemNet > CAS > 527-54-8 3,4,5-Trimethylphenol
527-54-8 3,4,5-Trimethylphenol
| Ονομασία του προϊόντος |
3,4,5-Trimethylphenol |
| Συνώνυμα |
Phenol, 3,4,5-trimethyl-; 1-Hydroxy-3,4,5-trimethylbenzene; 3,4,5-Hemimellitenol; 5-Hydroxy-1,2,3-trimethylbenzene; NSC 65648 |
| MF |
C9H12O |
| Μοριακό βάρος |
136.191 |
| InChI |
InChI=1/C9H12O/c1-6-4-9(10)5-7(2)8(6)3/h4-5,10H,1-3H3 |
| CAS ΟΧΙ |
527-54-8 |
| EINECS |
208-418-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.996g/cm3 |
| Σημείο τήξης |
109-98℃ |
| Σημείο βρασμού |
248.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.535 |
| Σημείο ανάφλεξης |
109.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
