ChemNet > CAS > 552-22-7 thymol iodide
552-22-7 thymol iodide
उत्पाद का नाम |
thymol iodide |
समानार्थी |
5,5-diisopropyl-2,2-dimethylbiphenyl-4,4-diyl dihypoiodite; Dithymol diiodide; 2,2'-dimethyl-5,5'-di(propan-2-yl)biphenyl-4,4'-diyl dihypoiodite |
आणविक फार्मूला |
C20H24I2O2 |
आण्विक वजन |
550.2123 |
InChI |
InChI=1/C20H24I2O2/c1-11(2)15-9-17(13(5)7-19(15)23-21)18-10-16(12(3)4)20(24-22)8-14(18)6/h7-12H,1-6H3 |
कैस रजिस्टी संख्या |
552-22-7 |
EINECS |
209-007-5 |
आणविक संरचना |
|
घनत्व |
1.617g/cm3 |
उबलने का समय |
479°C at 760 mmHg |
अपवर्तक सूचकांक |
1.616 |
फ्लैश प्वाइंट |
243.5°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|