609-08-5 Diethyl methylmalonate
| نام محصول |
Diethyl methylmalonate |
| نام انگلیسی |
Diethyl methylmalonate; Methylmalonic acid diethyl ester~Methylpropanedioic acid diethyl ester; Methoxymalonic Acid Diethyl Ester; RARECHEM AL BI 0301; 2-methyl-malonicaciddiethylester; 2-methyl-propanedioicaciddiethylester; Diethyl 2-methylmalonate; Diethylisosuccinate; dlethylmethylmalonate; Ethyl methylmalonate; Malonic acid, methyl-, diethyl ester; methyl-propanedioicacidiethylester; Propanedioic acid, 2-methyl-, diethyl ester; METHYLMALONIC ACID DIETHYL ESTER; DIETHYL 2-METHYLPROPANEDIOATE; DIETHYL METHYLMALONATE 99% (GC); Diethylmethylmalonate,99%; Diethyl methylpropanedioate |
| میدان مغناطیسی |
C8H14O4 |
| وزن مولکولی |
174.1944 |
| InChI |
InChI=1/C8H14O4/c1-4-11-7(9)6(3)8(10)12-5-2/h6H,4-5H2,1-3H3 |
| شماره سیایاس |
609-08-5 |
| تعداد کمیسیون اروپایی |
210-175-7 |
| ساختار مولکولی |
|
| تراکم |
1.037g/cm3 |
| نقطه غلیان |
204.4°C at 760 mmHg |
| ضریب شکست |
1.421 |
| نقطه اشتعال |
76.7°C |
| حلالیت آب |
immiscible |
| فشار بخار |
0.264mmHg at 25°C |
| توضیحات ایمنی |
S24/25:;
|
|