CAS No: 73942-87-7, Chemical Name: 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one
the physical and chemical property of 73942-87-7, 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one is provided by ChemNet.com
ChemNet > CAS > 73942-87-7 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one
73942-87-7 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one
| نام محصول |
7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one |
| مترادف |
1,3-Dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one; Intermediate of IVA 5; 2H-3-Benzazepin-2-one, 1,3-dihydro-7,8-dimethoxy-; 7,8-Dimethoxy-1,3-Dichloro-2H-3-Benzazepin-2-one |
| میدان مغناطیسی |
C12H13NO3 |
| وزن مولکولی |
219.2365 |
| InChI |
InChI=1/C12H13NO3/c1-15-10-5-8-3-4-13-12(14)7-9(8)6-11(10)16-2/h3-6H,7H2,1-2H3,(H,13,14) |
| شماره سیایاس |
73942-87-7 |
| ساختار مولکولی |
|
| تراکم |
1.167g/cm3 |
| نقطه غلیان |
455.8°C at 760 mmHg |
| ضریب شکست |
1.546 |
| نقطه اشتعال |
229.5°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
