ChemNet > CAS > 86484-91-5 Dopexamine hydrochloride
86484-91-5 Dopexamine hydrochloride
| نام محصول |
Dopexamine hydrochloride |
| نام انگلیسی |
Dopexamine hydrochloride; 4-[2-[[6-[(2-Phenylethyl)amino]hexyl]amino]ethyl]-1,2-benzenediol dihydrochloride; 4-[2-({6-[(2-phenylethyl)amino]hexyl}amino)ethyl]benzene-1,2-diol dihydrochloride |
| میدان مغناطیسی |
C22H34Cl2N2O2 |
| وزن مولکولی |
429.4236 |
| InChI |
InChI=1/C22H32N2O2.2ClH/c25-21-11-10-20(18-22(21)26)13-17-24-15-7-2-1-6-14-23-16-12-19-8-4-3-5-9-19;;/h3-5,8-11,18,23-26H,1-2,6-7,12-17H2;2*1H |
| شماره سیایاس |
86484-91-5 |
| ساختار مولکولی |
|
| نقطه غلیان |
546.7°C at 760 mmHg |
| نقطه اشتعال |
115.1°C |
| فشار بخار |
1.45E-12mmHg at 25°C |
|