97-45-0 (-)-پروپیونات کارویل؛
| نام محصول |
(-)-پروپیونات کارویل؛ |
| مترادف |
()-Carvyl propionate، مخلوط ایزومرها؛ p-mentha-1 (6)، 8-dien-2-yl پروپیونات؛ 2-متیل-5- (prop-1-en-2-yl) cyclohex-2-en-1-yl پروپانات؛ (1S، 5S) -2-متیل-5- (prop-1-en-2-yl) cyclohex-2-en-1-yl پروپانات؛ (1R، 5S) -2-متیل-5- (prop-1-en-2-yl) cyclohex-2-en-1-yl پروپانات؛ (1S، 5R) -2-متیل-5- (prop-1-en-2-yl) cyclohex-2-en-1-yl پروپانات؛ (1R، 5R) -2-متیل-5- (prop-1-en-2-yl) cyclohex-2-en-1-yl پروپانات؛ |
| نام انگلیسی |
(-)-Carvyl propionate; ()-Carvyl propionate,mixture of isomers; p-mentha-1(6),8-dien-2-yl propionate; 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1R,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate; (1R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-yl propanoate |
| میدان مغناطیسی |
C13H20O2 |
| وزن مولکولی |
208.2967 |
| InChI |
InChI=1/C13H20O2/c1-5-13(14)15-12-8-11(9(2)3)7-6-10(12)4/h6,11-12H,2,5,7-8H2,1,3-4H3/t11-,12-/m1/s1 |
| شماره سیایاس |
97-45-0 |
| تعداد کمیسیون اروپایی |
202-583-9 |
| ساختار مولکولی |
|
| تراکم |
0.95g/cm3 |
| نقطه غلیان |
287.5°C at 760 mmHg |
| ضریب شکست |
1.475 |
| نقطه اشتعال |
107.8°C |
| فشار بخار |
0.00247mmHg at 25°C |
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|