ChemNet > CAS > 124-48-1 Chlorodibromomethane
124-48-1 Chlorodibromomethane
상품명칭 |
Chlorodibromomethane |
별명 |
Dibromochloromethane |
분자식 |
CHBr2Cl |
분자량 |
208.2796 |
InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
cas번호 |
124-48-1 |
EC번호 |
204-704-0 |
분자 구조 |
|
밀도 |
2.504g/cm3 |
녹는 점 |
-22℃ |
비등점 |
117.1°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
19.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|