140-38-5 4-Chlorophenylurea
상품명칭 |
4-Chlorophenylurea |
영문 이름 |
4-Chlorophenylurea;Urea, 1-(p-chlorophenyl)-; (p-Chlorophenyl)urea; 1-(p-Chlorophenyl)urea; 4-12-00-01191 (Beilstein Handbook Reference); AI3-20197; BRN 0908492; NSC 12971; p-CPU; (4-Chlorophenyl)urea; Urea, (4-chlorophenyl)-; Urea, (p-chlorophenyl)- (8CI); 1-(4-chlorophenyl)urea |
분자식 |
C7H7ClN2O |
분자량 |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
cas번호 |
140-38-5 |
EC번호 |
205-412-6 |
분자 구조 |
|
밀도 |
1.402g/cm3 |
비등점 |
271.7°C at 760 mmHg |
굴절 지수 |
1.649 |
인화점 |
118.1°C |
증기압 |
0.00634mmHg at 25°C |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|