ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
| 상품명칭 |
Benzylidenemalononitrile |
| 영문 이름 |
Benzylidenemalononitrile; beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
| 분자식 |
C10H6N2 |
| 분자량 |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
| cas번호 |
2700-22-3 |
| EC번호 |
220-283-6 |
| 분자 구조 |
|
| 밀도 |
1.154g/cm3 |
| 녹는 점 |
82-86℃ |
| 비등점 |
294.8°C at 760 mmHg |
| 굴절 지수 |
1.612 |
| 인화점 |
138°C |
| 증기압 |
0.00159mmHg at 25°C |
| 위험성 표시 |
T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|