ChemNet > CAS > 83463-62-1 Bromochloroacetonitrile
83463-62-1 Bromochloroacetonitrile
상품명칭 |
Bromochloroacetonitrile |
별명 |
Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
분자식 |
C2HBrClN |
분자량 |
154.393 |
InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
cas번호 |
83463-62-1 |
분자 구조 |
|
밀도 |
1.932g/cm3 |
비등점 |
121.1°C at 760 mmHg |
굴절 지수 |
1.506 |
인화점 |
27.1°C |
위험성 표시 |
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|