ChemNet > CAS > 97-95-0 2-Ethyl-1-butanol
97-95-0 2-Ethyl-1-butanol
상품명칭 |
2-Ethyl-1-butanol |
별명 |
2-Ethylbutyl alcohol; 2-ethylbutan-1-ol |
분자식 |
C6H14O |
분자량 |
102.1748 |
InChI |
InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
cas번호 |
97-95-0 |
EC번호 |
202-621-4 |
분자 구조 |
|
밀도 |
0.814g/cm3 |
녹는 점 |
-15℃ |
비등점 |
146.5°C at 760 mmHg |
굴절 지수 |
1.413 |
인화점 |
58.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
|
보안 규칙 |
|
|