ChemNet > CAS > 99-29-6 2-Bromo-6-chloro-4-nitroaniline
99-29-6 2-Bromo-6-chloro-4-nitroaniline
| 상품명칭 |
2-Bromo-6-chloro-4-nitroaniline |
| 영문 이름 |
2-Bromo-6-chloro-4-nitroaniline; Benzenamine, 2-bromo-6-chloro-4-nitro-; NSC 88985; Aniline, 2-bromo-6-chloro-4-nitro-; 2-Chloro-4-nitro-6-bromoaniline; 2-Chloro-4-Niotro-6-Bromo aniline |
| 분자식 |
C6H4BrClN2O2 |
| 분자량 |
251.4652 |
| InChI |
InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| cas번호 |
99-29-6 |
| EC번호 |
202-745-9 |
| 분자 구조 |
|
| 밀도 |
1.909g/cm3 |
| 비등점 |
344.7°C at 760 mmHg |
| 굴절 지수 |
1.677 |
| 인화점 |
162.3°C |
| 증기압 |
6.47E-05mmHg at 25°C |
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|