ChemNet > CAS > 99-29-6 2-Bromo-6-chloro-4-nitroaniline
99-29-6 2-Bromo-6-chloro-4-nitroaniline
상품명칭 |
2-Bromo-6-chloro-4-nitroaniline |
별명 |
Benzenamine, 2-bromo-6-chloro-4-nitro-; NSC 88985; Aniline, 2-bromo-6-chloro-4-nitro-; 2-Chloro-4-nitro-6-bromoaniline |
분자식 |
C6H4BrClN2O2 |
분자량 |
251.4652 |
InChI |
InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
cas번호 |
99-29-6 |
EC번호 |
202-745-9 |
분자 구조 |
|
밀도 |
1.909g/cm3 |
비등점 |
344.7°C at 760 mmHg |
굴절 지수 |
1.677 |
인화점 |
162.3°C |
위험성 표시 |
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|