ChemNet > CAS > 459-05-2 1-(4-fluorophenyl)-2-thiourea
459-05-2 1-(4-fluorophenyl)-2-thiourea
Naam product |
1-(4-fluorophenyl)-2-thiourea |
Synoniemen |
4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
MF |
C7H7FN2S |
Molecuulgewicht |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-nummer |
459-05-2 |
Moleculaire Structuur |
|
Dichtheid |
1.397g/cm3 |
Smeltpunt |
164℃ |
Kookpunt |
264.2°C at 760 mmHg |
Brekingsindex |
1.692 |
Vlampunt |
113.6°C |
Gevaarsymbolen |
|
Risico-codes |
R25:Toxic if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|