ChemNet > CAS > 4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
Naam product |
trans-2,3-dihydroxy-1,4-dioxane |
Synoniemen |
2,3-Dihydroxy-1,4-dioxane; Glyoxal monoethylene acetal; Dioxanediol; 1,4-dioxane-2,3-diol; trans-1,4-Dioxane-2,3-diol |
MF |
C4H8O4 |
Molecuulgewicht |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2 |
CAS-nummer |
4845-50-5 |
EINECS |
225-431-3 |
Moleculaire Structuur |
|
Dichtheid |
1.455g/cm3 |
Smeltpunt |
91-95℃ |
Kookpunt |
259.4°C at 760 mmHg |
Brekingsindex |
1.513 |
Vlampunt |
110.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36:Irritating to eyes.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|