60-82-2 Phloretin
| Naam product |
Phloretin |
| Engelse naam |
Phloretin;2',4',6'-TRIHYDROXY-3-(4-HYDROXYPHENYL)PROPIOPHENONE; 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone; 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one; 1-(2,6-dihydroxy-4-methoxyphenyl)ethanone |
| MF |
C9H10O4 |
| Molecuulgewicht |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-5(10)9-7(11)3-6(13-2)4-8(9)12/h3-4,11-12H,1-2H3 |
| CAS-nummer |
60-82-2 |
| EINECS |
200-488-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.284g/cm3 |
| Smeltpunt |
260-262℃ |
| Kookpunt |
356.7°C at 760 mmHg |
| Brekingsindex |
1.572 |
| Vlampunt |
146.3°C |
| Oplosbaarheid in water |
soluble |
| Dampdruk |
1.4E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:;
|
| Veiligheid Omschrijving |
S26:;
S37/39:;
|
|