606-26-8 2-Nitrobenzhydrazide
| Naam product |
2-Nitrobenzhydrazide |
| Engelse naam |
2-Nitrobenzhydrazide; 2-Nitrobenzoic hydrazide; 2-Nitrobenzoyl hydrazide; 2-nitrobenzohydrazide |
| MF |
C7H7N3O3 |
| Molecuulgewicht |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS-nummer |
606-26-8 |
| EINECS |
210-110-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.406g/cm3 |
| Smeltpunt |
123℃ |
| Brekingsindex |
1.621 |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|