ChemNet > CAS > 538-65-8 butyl cinnamate
538-65-8 butyl cinnamate
اسم المنتج |
butyl cinnamate |
الاسم المستعار |
n-Butyl cinnamate, (Cinnamic acid n-butyl ester); Cinnamic acid n-butyl ester; n-Butyl cinnamate; butyl 3-phenylprop-2-enoate; butyl (2E)-3-phenylprop-2-enoate |
الصيغة الجزيئية |
C13H16O2 |
الوزن الجزيئي الغرامي |
204.2649 |
InChI |
InChI=1/C13H16O2/c1-2-3-11-15-13(14)10-9-12-7-5-4-6-8-12/h4-10H,2-3,11H2,1H3/b10-9+ |
إستراتيجية المساعدة القطرية |
538-65-8 |
المفوضية الأوروبية رقم |
208-699-6 |
بنية جزيئية |
|
كثافة |
1.021g/cm3 |
نقطة الغليان |
302.7°C at 760 mmHg |
معامل الإنكسار |
1.537 |
نقطة الوميض |
163.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|