104-76-7 2-Ethyl-1-hexanol
| product Name |
2-Ethyl-1-hexanol |
| CAS No |
104-76-7;26952-21-6 |
| Synonyms |
2-Ethylhexan-1-ol; 2-Ethylhexanol; 2-ethyl hexanol; octan-3-ol; titanium(4+) tetrakis(2-ethylhexan-1-olate); (2R)-2-ethylhexan-1-ol; (2S)-2-ethylhexan-1-ol; Isooctyl Alcohol; 2-EH; ISOOCTYL ALCOHOL;
|
| Molecular Formula |
C8H18O |
| Molecular Weight |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| EINECS |
203-234-3;248-133-5 |
| Molecular Structure |
|
| Density |
0.821g/cm3 |
| Melting point |
-76℃ |
| Boiling point |
184.6°C at 760 mmHg |
| Refractive index |
1.426 |
| Flash point |
77.2°C |
| Water solubility |
1 g/L (20℃) |
| Vapour Pressur |
0.207mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R21:;
R36:;
|
| Safety Description |
S26:;
S36/37/39:;
|
|
Featured China Suppliers
| Contact |
Lena |
| Telephone |
+86-13864755872 |
| Email |
lena@hongyanghuaxue.com |
| Address |
Meiyuan Building, Nanyi Road, Dongying City, Shandong Province, China |
| Telephone |
0086-21-50810808 |
| Email |
orisalt@public8.sta.net.cn |
| Address |
507 Suncome-Cimic tower, NO.1090 century avenue Pu Dong New Area, ShangHai |
| Description |
| Physical and chemical properties | Color Odor State: Colorless to pale yellow oily liquid | Toxicity: Low toxicity | Combustibility: flammable | Density: 0.833 | Volatility: very volatile | Boiling point: 183-186¡ãC | Stability: Stable | Melting point: -76¡ãC | Flash point: 77¡ãC | Solubility: Miscible with most organic solvents | Uses | Used as a solvent and preservative. It can also be used as the main plasticizer and cold-resistant auxiliary plasticizer, defoamer, dispersant, mineral dressing agent and petroleum filler of plastics, and also... |
| Telephone |
+86-546-6878189 |
| Email |
export2@chemlongxing.com |
| Address |
Dawang Economy Technology Development Zone,Guangrao County,Dongying City,Shandong Province,China. |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Telephone |
+86-21-61066956/57/58£¬61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
|