1319-77-3 Cresol
| product Name |
Cresol |
| CAS No |
1319-77-3 |
| Synonyms |
Cresol (mixed isomers); Methylphenol; Cresylic acid; Crude phenols; Crude carbolic acid; artoluenol; bacillol; coaltarphenols; cresoli; Cresols; m-cresol,o-cresol,p-cresol; Cresol(mixture of isomers) |
| Molecular Formula |
C7H8O |
| Molecular Weight |
108.1378 |
| InChI |
InChI=1/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 |
| EINECS |
215-293-2 |
| Molecular Structure |
|
| Density |
1.038g/cm3 |
| Melting point |
-1--2℃ |
| Boiling point |
190.999°C at 760 mmHg |
| Refractive index |
1.546 |
| Flash point |
77.052°C |
| Water solubility |
1.932 g/100 mL |
| Vapour Pressur |
0.379mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R20:;
R24/25:;
R34:;
R52/53:;
R68:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
S61:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Manager Zhang |
| Telephone |
+86-412-8410999,8425000,8439888 |
| Email |
beida@chinabeidachem.com |
| Address |
NO.3,Qianshan West Road,Qianshan district,Anshan City,Liaoning province,China |
| Contact |
Amy |
| Telephone |
+86-21-56301702 |
| Email |
sales@sh-orfila.com |
| Address |
Lane 1661, Jialuo highway, Jiading District, Shanghai, China |
| Description |
| Physicochemical properties | Color and odor state: colorless to light yellow liquid, with phenol-like odor, easy to change color if left for a long time or exposed to light | | Density: 1.03~1.05 | Toxicity: Toxic | | Spontaneous ignition point: 558°C | Boiling point: 190~205°C (mixed cresol). | | Melting point: 10~30°C (mixed cresol). | Flash point: 86°C (closed cup). | | Corrosive: Highly corrosive | Viscosity: medium viscosity | | Flammability: combustible | Volatility: Slightly volatile | | Stability: Stability | Decomposition: High temperature decomposition produces toxic corrosive flue gases | |
|
| Telephone |
+86-546-6878189 |
| Email |
export2@chemlongxing.com |
| Address |
Dawang Economy Technology Development Zone,Guangrao County,Dongying City,Shandong Province,China. |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Jiang Youan;Zong Bin |
| Telephone |
+86-555-5963786;5963788 |
| Email |
sales@weichichem.com |
| Address |
Fine Chemical Industrial Base,Wujiang town,He County,Anhui China. |
|