ChemNet > CAS > 451-13-8 2,5-Dihydroxyphenylacetic acid
451-13-8 2,5-Dihydroxyphenylacetic acid
| product Name |
2,5-Dihydroxyphenylacetic acid |
| CAS No |
451-13-8 |
| Synonyms |
homogentisic acid free acid; Homogentisic acid 2,5-Dihydroxyphenylacetic acid; Homogentisicacid; Homogentisic acid; (2,5-dihydroxyphenyl)acetate |
| Molecular Formula |
C8H7O4 |
| Molecular Weight |
167.1393 |
| InChI |
InChI=1/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1 |
| EINECS |
207-192-7 |
| Molecular Structure |
|
| Melting point |
147-153℃ |
| Boiling point |
439.3°C at 760 mmHg |
| Flash point |
233.6°C |
| Vapour Pressur |
1.71E-08mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|