ChemNet > CAS > 506-50-3 Triacontanoic acid
506-50-3 Triacontanoic acid
product Name |
Triacontanoic acid |
Molecular Formula |
C30H60O2 |
Molecular Weight |
452.7962 |
InChI |
InChI=1/C30H60O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30(31)32/h2-29H2,1H3,(H,31,32) |
CAS Registry Number |
506-50-3 |
EINECS |
208-042-3 |
Molecular Structure |
|
Density |
0.873g/cm3 |
Melting point |
91-94℃ |
Boiling point |
441.4°C at 760 mmHg |
Refractive index |
1.462 |
Flash point |
196.9°C |
Vapour Pressur |
1.44E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|