638-32-4 Succinamic acid
| product Name |
Succinamic acid |
| CAS No |
638-32-4 |
| Synonyms |
Butanedioic acid monoamide; 4-amino-4-oxobutanoic acid; 4-amino-4-oxobutanoate |
| Molecular Formula |
C4H6NO3 |
| Molecular Weight |
116.0959 |
| InChI |
InChI=1/C4H7NO3/c5-3(6)1-2-4(7)8/h1-2H2,(H2,5,6)(H,7,8)/p-1 |
| EINECS |
211-331-7 |
| Molecular Structure |
|
| Melting point |
153-157℃ |
| Boiling point |
421.3°C at 760 mmHg |
| Flash point |
208.6°C |
| Vapour Pressur |
2.8E-08mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|