79-09-4 Propionic acid
| product Name |
Propionic acid |
| CAS No |
79-09-4 |
| Synonyms |
Propionic acid solution; Propionic acid 99.0+ % (acidimetric) for analysis; Propanoic Acid; Natural Propionic Acid |
| Molecular Formula |
C3H6O2 |
| Molecular Weight |
74.08 |
| InChI |
InChI=1/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
| EINECS |
201-176-3 |
| Molecular Structure |
|
| Density |
0.9934 |
| Melting point |
-22℃ |
| Boiling point |
141℃ |
| Refractive index |
1.385-1.387 |
| Flash point |
51℃ |
| Water solubility |
37 g/100 mL |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:;
|
| Safety Description |
S23:;
S36:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Ada Yang |
| Telephone |
+86-311-87047555,87046555, 013803374860 |
| Email |
taihechem@tom.com yonghuah@263.net |
| Address |
Room 1901,Unit 5 FUTURE MALL BUILDING, No.58 Yucai Str.,Hebei,China |
| Description |
| Physicochemical properties | Color Odor Status: Colorless oily liquid with pungent odor | | Toxicity: low toxicity, irritation | Flammability: flammable | | Density: 0.99 | Volatility: Not easily volatile | | Corrosivity: Corrosive | Boiling point: 141.7 | | Stability: stable | Melting point: −24- | | Acidity: acidity | Flash point: 51.7 ¡ãC | | Solubility: miscible with water, soluble in ethanol, ether, chloroform | | Uses | Mainly used as food preservative... |
| Telephone |
+86-546-6878189 |
| Email |
export2@chemlongxing.com |
| Address |
Dawang Economy Technology Development Zone,Guangrao County,Dongying City,Shandong Province,China. |
| Contact |
Ms.Song;Pan Meilian |
| Telephone |
+86-571-64149273;64149298 |
| Email |
trade@chinaorganicchem.com |
| Address |
8 Yandongguan Road, Meicheng, Jiande, Zhejiang, China |
| Contact |
Pan Xiufen |
| Telephone |
+86-510-87503795 |
| Email |
sales@chinazr.com |
| Address |
Zhoutie Town, Yixing City, Jiangsu |
| Contact |
Mr Zhang |
| Telephone |
+86-577-88799961 88795800 88799963 88799960 88799962 |
| Email |
sales@cnjxchem.com |
| Address |
Yanjiang Industry Zone ,Wenzhou,China |
|