ChemNet > CAS > 82-07-5 Xanthene-9-carboxylic acid
82-07-5 Xanthene-9-carboxylic acid
| product Name |
Xanthene-9-carboxylic acid |
| CAS No |
82-07-5 |
| Synonyms |
xanthoic acid; Methyl xanthene-9-carboxylate; 9-Xanthene carboxylic acid; Xomthene-9-carboxylic methylester acid; 9H-xanthene-9-carboxylic acid; 9H-xanthene-9-carboxylate |
| Molecular Formula |
C14H9O3 |
| Molecular Weight |
225.22 |
| InChI |
InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
| EINECS |
201-394-9 |
| Molecular Structure |
|
| Melting point |
221-225℃ |
| Boiling point |
391.3°C at 760 mmHg |
| Flash point |
153.1°C |
| Vapour Pressur |
7.99E-07mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Li Chun |
| Telephone |
+86-519-82891186;82618618;82618688 |
| Email |
henrylee215@gmail.com |
| Address |
3 # Houyang chemical zone,Gold town,Jintan,Jiangsu,China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Telephone |
+86-510-82734258;82719958;85799581 |
| Email |
info@dintech.com.cn |
| Address |
20-D, Huaguang Mansion, 333 Zhong Shan Road, Wuxi,Jiangsu, China. |
| Telephone |
+86-21-61066956/57/58£¬61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |